C13H17N2O8P — CID 22460636
2-[[hydroxy-[(3-nitroanilino)methyl]phosphoryl]methyl]pentanedioic acid (PubChem CID 22460636) has the molecular formula C13H17N2O8P and a molecular weight of 360.26 g/mol. Its IUPAC name is 2-[[hydroxy-[(3-nitroanilino)methyl]phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[hydroxy-[(3-nitroanilino)methyl]phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22460636 |
| Molecular Formula | C13H17N2O8P |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[[hydroxy-[(3-nitroanilino)methyl]phosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)CNc1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C13H17N2O8P/c16-12(17)5-4-9(13(18)19)7-24(22,23)8-14-10-2-1-3-11(6-10)15(20)21/h1-3,6,9,14H,4-5,7-8H2,(H,16,17)(H,18,19)(H,22,23) |
| InChIKey | MLVDABKOQAFLSV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|