C19H21ClNO6P — CID 22460516
2-[[[(2-chloroanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 22460516) has the molecular formula C19H21ClNO6P and a molecular weight of 425.81 g/mol. Its IUPAC name is 2-[[[(2-chloroanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[[(2-chloroanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22460516 |
| Molecular Formula | C19H21ClNO6P |
| Molecular Weight | 425.81 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-[[[(2-chloroanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)C(Nc1ccccc1Cl)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H21ClNO6P/c20-15-8-4-5-9-16(15)21-18(13-6-2-1-3-7-13)28(26,27)12-14(19(24)25)10-11-17(22)23/h1-9,14,18,21H,10-12H2,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | FNCVQIJAJLXBNF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|