C20H22NO8P — CID 22460640
2-[[[(2-carboxyanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 22460640) has the molecular formula C20H22NO8P and a molecular weight of 435.37 g/mol. Its IUPAC name is 2-[[[(2-carboxyanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[[(2-carboxyanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22460640 |
| Molecular Formula | C20H22NO8P |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-[[[(2-carboxyanilino)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)C(Nc1ccccc1C(=O)O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H22NO8P/c22-17(23)11-10-14(19(24)25)12-30(28,29)18(13-6-2-1-3-7-13)21-16-9-5-4-8-15(16)20(26)27/h1-9,14,18,21H,10-12H2,(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | ZXHSBCQVWNUROO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|