C15H30NO5P — CID 58610822
5-amino-2-[[hydroxy(nonyl)phosphoryl]methyl]-5-oxopentanoic acid (PubChem CID 58610822) has the molecular formula C15H30NO5P and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-amino-2-[[hydroxy(nonyl)phosphoryl]methyl]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[hydroxy(nonyl)phosphoryl]methyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58610822 |
| Molecular Formula | C15H30NO5P |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 5-amino-2-[[hydroxy(nonyl)phosphoryl]methyl]-5-oxopentanoic acid |
| SMILES | CCCCCCCCCP(=O)(O)CC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H30NO5P/c1-2-3-4-5-6-7-8-11-22(20,21)12-13(15(18)19)9-10-14(16)17/h13H,2-12H2,1H3,(H2,16,17)(H,18,19)(H,20,21) |
| InChIKey | IQSBIZKXEBUWIY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|