C16H21O6P — CID 54066349
2-[1-[benzyl(hydroxy)phosphoryl]but-2-enyl]pentanedioic acid (PubChem CID 54066349) has the molecular formula C16H21O6P and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-[1-[benzyl(hydroxy)phosphoryl]but-2-enyl]pentanedioic acid.
| Compound Name | 2-[1-[benzyl(hydroxy)phosphoryl]but-2-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 54066349 |
| Molecular Formula | C16H21O6P |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[1-[benzyl(hydroxy)phosphoryl]but-2-enyl]pentanedioic acid |
| SMILES | CC=CC(C(CCC(=O)O)C(=O)O)P(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H21O6P/c1-2-6-14(13(16(19)20)9-10-15(17)18)23(21,22)11-12-7-4-3-5-8-12/h2-8,13-14H,9-11H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | MDGORJFTDQJNSF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|