C12H16NO6P — CID 19357725
2-[1-[hydroxy(pyridin-2-yl)phosphoryl]ethyl]pentanedioic acid (PubChem CID 19357725) has the molecular formula C12H16NO6P and a molecular weight of 301.24 g/mol. Its IUPAC name is 2-[1-[hydroxy(pyridin-2-yl)phosphoryl]ethyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy(pyridin-2-yl)phosphoryl]ethyl]pentanedioic acid |
|---|---|
| PubChem CID | 19357725 |
| Molecular Formula | C12H16NO6P |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[1-[hydroxy(pyridin-2-yl)phosphoryl]ethyl]pentanedioic acid |
| SMILES | CC(C(CCC(=O)O)C(=O)O)P(=O)(O)c1ccccn1 |
| InChI | InChI=1S/C12H16NO6P/c1-8(9(12(16)17)5-6-11(14)15)20(18,19)10-4-2-3-7-13-10/h2-4,7-9H,5-6H2,1H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | MEHWELMZYMWSFX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|