C22H21O6P — CID 19357810
2-[[hydroxy(naphthalen-1-yl)phosphoryl]-phenylmethyl]pentanedioic acid (PubChem CID 19357810) has the molecular formula C22H21O6P and a molecular weight of 412.38 g/mol. Its IUPAC name is 2-[[hydroxy(naphthalen-1-yl)phosphoryl]-phenylmethyl]pentanedioic acid.
| Compound Name | 2-[[hydroxy(naphthalen-1-yl)phosphoryl]-phenylmethyl]pentanedioic acid |
|---|---|
| PubChem CID | 19357810 |
| Molecular Formula | C22H21O6P |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[[hydroxy(naphthalen-1-yl)phosphoryl]-phenylmethyl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)C(c1ccccc1)P(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H21O6P/c23-20(24)14-13-18(22(25)26)21(16-8-2-1-3-9-16)29(27,28)19-12-6-10-15-7-4-5-11-17(15)19/h1-12,18,21H,13-14H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | NNOORYMCDHHFIF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|