C15H21O6P — CID 19357738
2-[1-[hydroxy(1-phenylethyl)phosphoryl]ethyl]pentanedioic acid (PubChem CID 19357738) has the molecular formula C15H21O6P and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-[1-[hydroxy(1-phenylethyl)phosphoryl]ethyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy(1-phenylethyl)phosphoryl]ethyl]pentanedioic acid |
|---|---|
| PubChem CID | 19357738 |
| Molecular Formula | C15H21O6P |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[1-[hydroxy(1-phenylethyl)phosphoryl]ethyl]pentanedioic acid |
| SMILES | CC(c1ccccc1)P(=O)(O)C(C)C(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21O6P/c1-10(12-6-4-3-5-7-12)22(20,21)11(2)13(15(18)19)8-9-14(16)17/h3-7,10-11,13H,8-9H2,1-2H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | OYXVFHXDKRUODE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|