C14H17NO8P+ — CID 69297065
[3,5-dicarboxy-1-(carboxyamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium (PubChem CID 69297065) has the molecular formula C14H17NO8P+ and a molecular weight of 358.26 g/mol. Its IUPAC name is [3,5-dicarboxy-1-(carboxyamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium.
| Compound Name | [3,5-dicarboxy-1-(carboxyamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69297065 |
| Molecular Formula | C14H17NO8P+ |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [3,5-dicarboxy-1-(carboxyamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium |
| SMILES | O=C(O)CCC(C(=O)O)C(C(NC(=O)O)c1ccccc1)[P+](=O)O |
| InChI | InChI=1S/C14H16NO8P/c16-10(17)7-6-9(13(18)19)12(24(22)23)11(15-14(20)21)8-4-2-1-3-5-8/h1-5,9,11-12,15H,6-7H2,(H3-,16,17,18,19,20,21,22,23)/p+1 |
| InChIKey | WOEXKDNOUNTCDH-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|