C13H17NO6P+ — CID 69294668
(1-anilino-3,5-dicarboxypentan-2-yl)-hydroxy-oxophosphanium (PubChem CID 69294668) has the molecular formula C13H17NO6P+ and a molecular weight of 314.25 g/mol. Its IUPAC name is (1-anilino-3,5-dicarboxypentan-2-yl)-hydroxy-oxophosphanium.
| Compound Name | (1-anilino-3,5-dicarboxypentan-2-yl)-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69294668 |
| Molecular Formula | C13H17NO6P+ |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (1-anilino-3,5-dicarboxypentan-2-yl)-hydroxy-oxophosphanium |
| SMILES | O=C(O)CCC(C(=O)O)C(CNc1ccccc1)[P+](=O)O |
| InChI | InChI=1S/C13H16NO6P/c15-12(16)7-6-10(13(17)18)11(21(19)20)8-14-9-4-2-1-3-5-9/h1-5,10-11,14H,6-8H2,(H2-,15,16,17,18,19,20)/p+1 |
| InChIKey | YWEFNNILFZFTDH-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|