C14H19NO7P+ — CID 69295089
[3,5-dicarboxy-1-(2-methoxyanilino)pentan-2-yl]-hydroxy-oxophosphanium (PubChem CID 69295089) has the molecular formula C14H19NO7P+ and a molecular weight of 344.28 g/mol. Its IUPAC name is [3,5-dicarboxy-1-(2-methoxyanilino)pentan-2-yl]-hydroxy-oxophosphanium.
| Compound Name | [3,5-dicarboxy-1-(2-methoxyanilino)pentan-2-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69295089 |
| Molecular Formula | C14H19NO7P+ |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [3,5-dicarboxy-1-(2-methoxyanilino)pentan-2-yl]-hydroxy-oxophosphanium |
| SMILES | COc1ccccc1NCC(C(CCC(=O)O)C(=O)O)[P+](=O)O |
| InChI | InChI=1S/C14H18NO7P/c1-22-11-5-3-2-4-10(11)15-8-12(23(20)21)9(14(18)19)6-7-13(16)17/h2-5,9,12,15H,6-8H2,1H3,(H2-,16,17,18,19,20,21)/p+1 |
| InChIKey | SOQBOWGJCAASMA-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|