C13H17NO7P+ — CID 69296366
[3,5-dicarboxy-1-(3-hydroxyanilino)pentan-2-yl]-hydroxy-oxophosphanium (PubChem CID 69296366) has the molecular formula C13H17NO7P+ and a molecular weight of 330.25 g/mol. Its IUPAC name is [3,5-dicarboxy-1-(3-hydroxyanilino)pentan-2-yl]-hydroxy-oxophosphanium.
| Compound Name | [3,5-dicarboxy-1-(3-hydroxyanilino)pentan-2-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69296366 |
| Molecular Formula | C13H17NO7P+ |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [3,5-dicarboxy-1-(3-hydroxyanilino)pentan-2-yl]-hydroxy-oxophosphanium |
| SMILES | O=C(O)CCC(C(=O)O)C(CNc1cccc(O)c1)[P+](=O)O |
| InChI | InChI=1S/C13H16NO7P/c15-9-3-1-2-8(6-9)14-7-11(22(20)21)10(13(18)19)4-5-12(16)17/h1-3,6,10-11,14H,4-5,7H2,(H3-,15,16,17,18,19,20,21)/p+1 |
| InChIKey | ISHUBAWOKLFWPX-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|