C11H18Cl2N2O3 — CID 131859895
(2S)-2-amino-5-(3-hydroxyanilino)pentanoic acid;dihydrochloride (PubChem CID 131859895) has the molecular formula C11H18Cl2N2O3 and a molecular weight of 297.18 g/mol. Its IUPAC name is (2S)-2-amino-5-(3-hydroxyanilino)pentanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-5-(3-hydroxyanilino)pentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 131859895 |
| Molecular Formula | C11H18Cl2N2O3 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (2S)-2-amino-5-(3-hydroxyanilino)pentanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CCCNc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C11H16N2O3.2ClH/c12-10(11(15)16)5-2-6-13-8-3-1-4-9(14)7-8;;/h1,3-4,7,10,13-14H,2,5-6,12H2,(H,15,16);2*1H/t10-;;/m0../s1 |
| InChIKey | SFMGLMHDAQCAKJ-XRIOVQLTSA-N |
| XLogP | 1.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|