C13H21N3O4 — CID 90018517
2-anilinoacetic acid;2,5-diaminopentanoic acid (PubChem CID 90018517) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-anilinoacetic acid;2,5-diaminopentanoic acid.
| Compound Name | 2-anilinoacetic acid;2,5-diaminopentanoic acid |
|---|---|
| PubChem CID | 90018517 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-anilinoacetic acid;2,5-diaminopentanoic acid |
| SMILES | NCCCC(N)C(=O)O.O=C(O)CNc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C5H12N2O2/c10-8(11)6-9-7-4-2-1-3-5-7;6-3-1-2-4(7)5(8)9/h1-5,9H,6H2,(H,10,11);4H,1-3,6-7H2,(H,8,9) |
| InChIKey | AFZQZKCNPAKXSL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |