C27H29NO6P+ — CID 69296395
[3,5-dicarboxy-1-(dibenzylamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium (PubChem CID 69296395) has the molecular formula C27H29NO6P+ and a molecular weight of 494.50 g/mol. Its IUPAC name is [3,5-dicarboxy-1-(dibenzylamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium.
| Compound Name | [3,5-dicarboxy-1-(dibenzylamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69296395 |
| Molecular Formula | C27H29NO6P+ |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | [3,5-dicarboxy-1-(dibenzylamino)-1-phenylpentan-2-yl]-hydroxy-oxophosphanium |
| SMILES | O=C(O)CCC(C(=O)O)C(C(c1ccccc1)N(Cc1ccccc1)Cc1ccccc1)[P+](=O)O |
| InChI | InChI=1S/C27H28NO6P/c29-24(30)17-16-23(27(31)32)26(35(33)34)25(22-14-8-3-9-15-22)28(18-20-10-4-1-5-11-20)19-21-12-6-2-7-13-21/h1-15,23,25-26H,16-19H2,(H2-,29,30,31,32,33,34)/p+1 |
| InChIKey | TWAULNZTDNFUSS-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|