C13H16O6P+ — CID 70151667
(3,5-dicarboxy-1-phenylpentan-2-yl)-hydroxy-oxophosphanium (PubChem CID 70151667) has the molecular formula C13H16O6P+ and a molecular weight of 299.24 g/mol. Its IUPAC name is (3,5-dicarboxy-1-phenylpentan-2-yl)-hydroxy-oxophosphanium.
| Compound Name | (3,5-dicarboxy-1-phenylpentan-2-yl)-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70151667 |
| Molecular Formula | C13H16O6P+ |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (3,5-dicarboxy-1-phenylpentan-2-yl)-hydroxy-oxophosphanium |
| SMILES | O=C(O)CCC(C(=O)O)C(Cc1ccccc1)[P+](=O)O |
| InChI | InChI=1S/C13H15O6P/c14-12(15)7-6-10(13(16)17)11(20(18)19)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H2-,14,15,16,17,18,19)/p+1 |
| InChIKey | KUUDKBBXTNWTLQ-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|