C15H20O6S — CID 22460496
2-(1-methylsulfonyl-3-phenylpropan-2-yl)pentanedioic acid (PubChem CID 22460496) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-(1-methylsulfonyl-3-phenylpropan-2-yl)pentanedioic acid.
| Compound Name | 2-(1-methylsulfonyl-3-phenylpropan-2-yl)pentanedioic acid |
|---|---|
| PubChem CID | 22460496 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-(1-methylsulfonyl-3-phenylpropan-2-yl)pentanedioic acid |
| SMILES | CS(=O)(=O)CC(Cc1ccccc1)C(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20O6S/c1-22(20,21)10-12(9-11-5-3-2-4-6-11)13(15(18)19)7-8-14(16)17/h2-6,12-13H,7-10H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | OCWGTBGIAGNUOX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |