C15H22N2O5S — CID 120547199
4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-5-phenylpentanoic acid (PubChem CID 120547199) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120547199 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-5-phenylpentanoic acid |
| SMILES | CN(CC(=O)NC(CCC(=O)O)Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H22N2O5S/c1-17(23(2,21)22)11-14(18)16-13(8-9-15(19)20)10-12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | ALYJYFGSVVALRE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |