C16H24N2O4 — CID 122027582
4-[[[(2R)-2-hydroxypropyl]-methylcarbamoyl]amino]-5-phenylpentanoic acid (PubChem CID 122027582) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[[[(2R)-2-hydroxypropyl]-methylcarbamoyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[[(2R)-2-hydroxypropyl]-methylcarbamoyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027582 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-[[[(2R)-2-hydroxypropyl]-methylcarbamoyl]amino]-5-phenylpentanoic acid |
| SMILES | C[C@@H](O)CN(C)C(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O4/c1-12(19)11-18(2)16(22)17-14(8-9-15(20)21)10-13-6-4-3-5-7-13/h3-7,12,14,19H,8-11H2,1-2H3,(H,17,22)(H,20,21)/t12-,14?/m1/s1 |
| InChIKey | CKOWSXUKYWASQR-PUODRLBUSA-N |
| XLogP | 1.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |