C18H22N2O4 — CID 122027340
4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-5-phenylpentanoic acid (PubChem CID 122027340) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027340 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-5-phenylpentanoic acid |
| SMILES | CN(Cc1ccco1)C(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-20(13-16-8-5-11-24-16)18(23)19-15(9-10-17(21)22)12-14-6-3-2-4-7-14/h2-8,11,15H,9-10,12-13H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | RSWUASTYFRTDJO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |