C20H22O6 — CID 172870226
(2S,3S)-2,3-bis[(4-hydroxyphenyl)methyl]hexanedioic acid (PubChem CID 172870226) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[(4-hydroxyphenyl)methyl]hexanedioic acid.
| Compound Name | (2S,3S)-2,3-bis[(4-hydroxyphenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 172870226 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2S,3S)-2,3-bis[(4-hydroxyphenyl)methyl]hexanedioic acid |
| SMILES | O=C(O)CC[C@@H](Cc1ccc(O)cc1)[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H22O6/c21-16-6-1-13(2-7-16)11-15(5-10-19(23)24)18(20(25)26)12-14-3-8-17(22)9-4-14/h1-4,6-9,15,18,21-22H,5,10-12H2,(H,23,24)(H,25,26)/t15-,18-/m0/s1 |
| InChIKey | VPQZCYXLVKJBHN-YJBOKZPZSA-N |
| XLogP | 3.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |