C20H22O10 — CID 172870233
(2R,3R)-2,3-bis[(3,4,5-trihydroxyphenyl)methyl]hexanedioic acid (PubChem CID 172870233) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(3,4,5-trihydroxyphenyl)methyl]hexanedioic acid.
| Compound Name | (2R,3R)-2,3-bis[(3,4,5-trihydroxyphenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 172870233 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (2R,3R)-2,3-bis[(3,4,5-trihydroxyphenyl)methyl]hexanedioic acid |
| SMILES | O=C(O)CC[C@H](Cc1cc(O)c(O)c(O)c1)[C@@H](Cc1cc(O)c(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C20H22O10/c21-13-5-9(6-14(22)18(13)27)3-11(1-2-17(25)26)12(20(29)30)4-10-7-15(23)19(28)16(24)8-10/h5-8,11-12,21-24,27-28H,1-4H2,(H,25,26)(H,29,30)/t11-,12-/m1/s1 |
| InChIKey | SGZZDIIKRUDMEP-VXGBXAGGSA-N |
| XLogP | 1.89 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|