C11H14O6 — CID 52920331
4-hydroxy-5-(3,4,5-trihydroxyphenyl)pentanoic acid (PubChem CID 52920331) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-hydroxy-5-(3,4,5-trihydroxyphenyl)pentanoic acid.
| Compound Name | 4-hydroxy-5-(3,4,5-trihydroxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 52920331 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-hydroxy-5-(3,4,5-trihydroxyphenyl)pentanoic acid |
| SMILES | O=C(O)CCC(O)Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C11H14O6/c12-7(1-2-10(15)16)3-6-4-8(13)11(17)9(14)5-6/h4-5,7,12-14,17H,1-3H2,(H,15,16) |
| InChIKey | YQEDZQHHBNDZEM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|