C15H16O2P+ — CID 151391700
1,3-diphenylpropan-2-yl-hydroxy-oxophosphanium (PubChem CID 151391700) has the molecular formula C15H16O2P+ and a molecular weight of 259.27 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-yl-hydroxy-oxophosphanium.
| Compound Name | 1,3-diphenylpropan-2-yl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 151391700 |
| Molecular Formula | C15H16O2P+ |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1,3-diphenylpropan-2-yl-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15O2P/c16-18(17)15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2/p+1 |
| InChIKey | FDAMAVDGJJNQKL-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|