C15H17ClO3P+ — CID 70071894
1,3-diphenylpropan-2-yloxy-hydroxy-oxophosphanium;hydrochloride (PubChem CID 70071894) has the molecular formula C15H17ClO3P+ and a molecular weight of 311.73 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-yloxy-hydroxy-oxophosphanium;hydrochloride.
| Compound Name | 1,3-diphenylpropan-2-yloxy-hydroxy-oxophosphanium;hydrochloride |
|---|---|
| PubChem CID | 70071894 |
| Molecular Formula | C15H17ClO3P+ |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1,3-diphenylpropan-2-yloxy-hydroxy-oxophosphanium;hydrochloride |
| SMILES | Cl.O=[P+](O)OC(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15O3P.ClH/c16-19(17)18-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;/h1-10,15H,11-12H2;1H/p+1 |
| InChIKey | PTWFTKPQKJPRMU-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|