C21H20O — CID 54221058
1,3-diphenylpropan-2-yloxybenzene (PubChem CID 54221058) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-yloxybenzene.
| Compound Name | 1,3-diphenylpropan-2-yloxybenzene |
|---|---|
| PubChem CID | 54221058 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1,3-diphenylpropan-2-yloxybenzene |
| SMILES | c1ccc(CC(Cc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20O/c1-4-10-18(11-5-1)16-21(17-19-12-6-2-7-13-19)22-20-14-8-3-9-15-20/h1-15,21H,16-17H2 |
| InChIKey | QCPXQNOHCDABQY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |