About 1,3-diphenylpropan-2-yl diphenyl phosphate
1,3-diphenylpropan-2-yl diphenyl phosphate (PubChem CID 45103115) has the molecular formula C27H25O4P
and a molecular weight of 444.47 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-yl diphenyl phosphate.
Molecular Properties
| Compound Name | 1,3-diphenylpropan-2-yl diphenyl phosphate |
| PubChem CID | 45103115 |
| Molecular Formula | C27H25O4P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1,3-diphenylpropan-2-yl diphenyl phosphate |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)OC(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H25O4P/c28-32(29-25-17-9-3-10-18-25,30-26-19-11-4-12-20-26)31-27(21-23-13-5-1-6-14-23)22-24-15-7-2-8-16-24/h1-20,27H,21-22H2 |
| InChIKey | XOMBPUSJNGQNJD-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diphenylpropan-2-yl diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diphenylpropan-2-yl diphenyl phosphate?
The IUPAC name of 1,3-diphenylpropan-2-yl diphenyl phosphate (CID 45103115) is 1,3-diphenylpropan-2-yl diphenyl phosphate.
What is the SMILES notation for 1,3-diphenylpropan-2-yl diphenyl phosphate?
The canonical SMILES for 1,3-diphenylpropan-2-yl diphenyl phosphate is O=P(Oc1ccccc1)(Oc1ccccc1)OC(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 1,3-diphenylpropan-2-yl diphenyl phosphate?
The InChIKey is XOMBPUSJNGQNJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25O4P/c28-32(29-25-17-9-3-10-18-25,30-26-19-11-4-12-20-26)31-27(21-23-13-5-1-6-14-23)22-24-15-7-2-8-16-24/h1-20,27H,21-22H2.
What are the key properties of 1,3-diphenylpropan-2-yl diphenyl phosphate?
1,3-diphenylpropan-2-yl diphenyl phosphate has a molecular weight of 444.47 g/mol, XLogP of 7.12, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diphenylpropan-2-yl diphenyl phosphate is sourced from PubChem (CID 45103115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).