C28H26O3P+ — CID 57192035
bis(1,2-diphenylethoxy)-oxophosphanium (PubChem CID 57192035) has the molecular formula C28H26O3P+ and a molecular weight of 441.49 g/mol. Its IUPAC name is bis(1,2-diphenylethoxy)-oxophosphanium.
| Compound Name | bis(1,2-diphenylethoxy)-oxophosphanium |
|---|---|
| PubChem CID | 57192035 |
| Molecular Formula | C28H26O3P+ |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | bis(1,2-diphenylethoxy)-oxophosphanium |
| SMILES | O=[P+](OC(Cc1ccccc1)c1ccccc1)OC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26O3P/c29-32(30-27(25-17-9-3-10-18-25)21-23-13-5-1-6-14-23)31-28(26-19-11-4-12-20-26)22-24-15-7-2-8-16-24/h1-20,27-28H,21-22H2/q+1 |
| InChIKey | IIBXDPAZQXKAPG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|