C16H18OSi — CID 123377665
1,2-diphenylethoxy(ethenyl)silane (PubChem CID 123377665) has the molecular formula C16H18OSi and a molecular weight of 254.41 g/mol. Its IUPAC name is 1,2-diphenylethoxy(ethenyl)silane.
| Compound Name | 1,2-diphenylethoxy(ethenyl)silane |
|---|---|
| PubChem CID | 123377665 |
| Molecular Formula | C16H18OSi |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1,2-diphenylethoxy(ethenyl)silane |
| SMILES | C=C[SiH2]OC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18OSi/c1-2-18-17-16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h2-12,16H,1,13,18H2 |
| InChIKey | CGZUFMPBWRKZGQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|