C24H34ClN — CID 88731072
dibutyl-(1,2-diphenylethyl)-ethenylazanium chloride (PubChem CID 88731072) has the molecular formula C24H34ClN and a molecular weight of 372.00 g/mol. Its IUPAC name is dibutyl-(1,2-diphenylethyl)-ethenylazanium chloride.
| Compound Name | dibutyl-(1,2-diphenylethyl)-ethenylazanium chloride |
|---|---|
| PubChem CID | 88731072 |
| Molecular Formula | C24H34ClN |
| Molecular Weight | 372.00 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | dibutyl-(1,2-diphenylethyl)-ethenylazanium chloride |
| SMILES | C=C[N+](CCCC)(CCCC)C(Cc1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C24H34N.ClH/c1-4-7-19-25(6-3,20-8-5-2)24(23-17-13-10-14-18-23)21-22-15-11-9-12-16-22;/h6,9-18,24H,3-5,7-8,19-21H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZXSYCKMGKYQQLS-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.00 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|