C18H24ClN — CID 175355972
1,2-diphenylethyl-ethyl-dimethylazanium chloride (PubChem CID 175355972) has the molecular formula C18H24ClN and a molecular weight of 289.85 g/mol. Its IUPAC name is 1,2-diphenylethyl-ethyl-dimethylazanium chloride.
| Compound Name | 1,2-diphenylethyl-ethyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 175355972 |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1,2-diphenylethyl-ethyl-dimethylazanium chloride |
| SMILES | CC[N+](C)(C)C(Cc1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H24N.ClH/c1-4-19(2,3)18(17-13-9-6-10-14-17)15-16-11-7-5-8-12-16;/h5-14,18H,4,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | MTXFPOXKJIVYSD-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|