C22H24ClNO — CID 25094007
N-(1,2-diphenylethoxy)-2-phenylethanamine;hydrochloride (PubChem CID 25094007) has the molecular formula C22H24ClNO and a molecular weight of 353.89 g/mol. Its IUPAC name is N-(1,2-diphenylethoxy)-2-phenylethanamine;hydrochloride.
| Compound Name | N-(1,2-diphenylethoxy)-2-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 25094007 |
| Molecular Formula | C22H24ClNO |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-(1,2-diphenylethoxy)-2-phenylethanamine;hydrochloride |
| SMILES | Cl.c1ccc(CCNOC(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO.ClH/c1-4-10-19(11-5-1)16-17-23-24-22(21-14-8-3-9-15-21)18-20-12-6-2-7-13-20;/h1-15,22-23H,16-18H2;1H |
| InChIKey | OPRUNIKYJKIXMU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|