C24H24O3P+ — CID 68515093
1,2-diphenylethoxy-oxo-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 68515093) has the molecular formula C24H24O3P+ and a molecular weight of 391.43 g/mol. Its IUPAC name is 1,2-diphenylethoxy-oxo-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | 1,2-diphenylethoxy-oxo-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 68515093 |
| Molecular Formula | C24H24O3P+ |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1,2-diphenylethoxy-oxo-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | Cc1cc(C)c(C(=O)[P+](=O)OC(Cc2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H24O3P/c1-17-14-18(2)23(19(3)15-17)24(25)28(26)27-22(21-12-8-5-9-13-21)16-20-10-6-4-7-11-20/h4-15,22H,16H2,1-3H3/q+1 |
| InChIKey | LDQRHKMTBFZPEJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|