C26H30O3P+ — CID 157077671
2-methyl-1-phenylpropan-2-ol;oxo-phenyl-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 157077671) has the molecular formula C26H30O3P+ and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-methyl-1-phenylpropan-2-ol;oxo-phenyl-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | 2-methyl-1-phenylpropan-2-ol;oxo-phenyl-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 157077671 |
| Molecular Formula | C26H30O3P+ |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-methyl-1-phenylpropan-2-ol;oxo-phenyl-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | CC(C)(O)Cc1ccccc1.Cc1cc(C)c(C(=O)[P+](=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H16O2P.C10H14O/c1-11-9-12(2)15(13(3)10-11)16(17)19(18)14-7-5-4-6-8-14;1-10(2,11)8-9-6-4-3-5-7-9/h4-10H,1-3H3;3-7,11H,8H2,1-2H3/q+1; |
| InChIKey | FEMBXYOUVHVOOK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|