C16H16O2P+ — CID 141016786
oxo-phenyl-(2,3,6-trimethylbenzoyl)phosphanium (PubChem CID 141016786) has the molecular formula C16H16O2P+ and a molecular weight of 271.28 g/mol. Its IUPAC name is oxo-phenyl-(2,3,6-trimethylbenzoyl)phosphanium.
| Compound Name | oxo-phenyl-(2,3,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 141016786 |
| Molecular Formula | C16H16O2P+ |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | oxo-phenyl-(2,3,6-trimethylbenzoyl)phosphanium |
| SMILES | Cc1ccc(C)c(C(=O)[P+](=O)c2ccccc2)c1C |
| InChI | InChI=1S/C16H16O2P/c1-11-9-10-12(2)15(13(11)3)16(17)19(18)14-7-5-4-6-8-14/h4-10H,1-3H3/q+1 |
| InChIKey | RVAIHLJTLLGODT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|