C25H24O3P+ — CID 174384218
[4-(2,6-dimethylbenzoyl)-2,3,6-trimethylbenzoyl]-oxo-phenylphosphanium (PubChem CID 174384218) has the molecular formula C25H24O3P+ and a molecular weight of 403.44 g/mol. Its IUPAC name is [4-(2,6-dimethylbenzoyl)-2,3,6-trimethylbenzoyl]-oxo-phenylphosphanium.
| Compound Name | [4-(2,6-dimethylbenzoyl)-2,3,6-trimethylbenzoyl]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 174384218 |
| Molecular Formula | C25H24O3P+ |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [4-(2,6-dimethylbenzoyl)-2,3,6-trimethylbenzoyl]-oxo-phenylphosphanium |
| SMILES | Cc1cccc(C)c1C(=O)c1cc(C)c(C(=O)[P+](=O)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C25H24O3P/c1-15-10-9-11-16(2)22(15)24(26)21-14-17(3)23(19(5)18(21)4)25(27)29(28)20-12-7-6-8-13-20/h6-14H,1-5H3/q+1 |
| InChIKey | BDWVIWZFZJOMRV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|