C23H19ClO3P+ — CID 70017070
(3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium (PubChem CID 70017070) has the molecular formula C23H19ClO3P+ and a molecular weight of 409.83 g/mol. Its IUPAC name is (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium.
| Compound Name | (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium |
|---|---|
| PubChem CID | 70017070 |
| Molecular Formula | C23H19ClO3P+ |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium |
| SMILES | Cc1cccc(Cl)c1C(=O)[P+](=O)c1c(C)ccc(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C23H19ClO3P/c1-14-8-7-11-19(24)20(14)23(26)28(27)22-15(2)12-13-18(16(22)3)21(25)17-9-5-4-6-10-17/h4-13H,1-3H3/q+1 |
| InChIKey | AFQRLPABJJBIFX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|