About (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium
(3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium (PubChem CID 70017070) has the molecular formula C23H19ClO3P+
and a molecular weight of 409.83 g/mol. Its IUPAC name is (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium.
Molecular Properties
| Compound Name | (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium |
| PubChem CID | 70017070 |
| Molecular Formula | C23H19ClO3P+ |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium |
| SMILES | Cc1cccc(Cl)c1C(=O)[P+](=O)c1c(C)ccc(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C23H19ClO3P/c1-14-8-7-11-19(24)20(14)23(26)28(27)22-15(2)12-13-18(16(22)3)21(25)17-9-5-4-6-10-17/h4-13H,1-3H3/q+1 |
| InChIKey | AFQRLPABJJBIFX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium?
The IUPAC name of (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium (CID 70017070) is (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium.
What is the SMILES notation for (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium?
The canonical SMILES for (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium is Cc1cccc(Cl)c1C(=O)[P+](=O)c1c(C)ccc(C(=O)c2ccccc2)c1C.
What is the InChIKey of (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium?
The InChIKey is AFQRLPABJJBIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClO3P/c1-14-8-7-11-19(24)20(14)23(26)28(27)22-15(2)12-13-18(16(22)3)21(25)17-9-5-4-6-10-17/h4-13H,1-3H3/q+1.
What are the key properties of (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium?
(3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium has a molecular weight of 409.83 g/mol, XLogP of 5.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-2,6-dimethylphenyl)-(2-chloro-6-methylbenzoyl)-oxophosphanium is sourced from PubChem (CID 70017070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).