C21H25ClO2P+ — CID 70016775
(2-chloro-6-methylbenzoyl)-oxo-(7-phenylheptyl)phosphanium (PubChem CID 70016775) has the molecular formula C21H25ClO2P+ and a molecular weight of 375.86 g/mol. Its IUPAC name is (2-chloro-6-methylbenzoyl)-oxo-(7-phenylheptyl)phosphanium.
| Compound Name | (2-chloro-6-methylbenzoyl)-oxo-(7-phenylheptyl)phosphanium |
|---|---|
| PubChem CID | 70016775 |
| Molecular Formula | C21H25ClO2P+ |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2-chloro-6-methylbenzoyl)-oxo-(7-phenylheptyl)phosphanium |
| SMILES | Cc1cccc(Cl)c1C(=O)[P+](=O)CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C21H25ClO2P/c1-17-11-10-15-19(22)20(17)21(23)25(24)16-9-4-2-3-6-12-18-13-7-5-8-14-18/h5,7-8,10-11,13-15H,2-4,6,9,12,16H2,1H3/q+1 |
| InChIKey | ISARPDGLVSPHGG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|