C20H23ClO3P+ — CID 70016693
(2-chloro-6-methoxybenzoyl)-oxo-(6-phenylhexyl)phosphanium (PubChem CID 70016693) has the molecular formula C20H23ClO3P+ and a molecular weight of 377.83 g/mol. Its IUPAC name is (2-chloro-6-methoxybenzoyl)-oxo-(6-phenylhexyl)phosphanium.
| Compound Name | (2-chloro-6-methoxybenzoyl)-oxo-(6-phenylhexyl)phosphanium |
|---|---|
| PubChem CID | 70016693 |
| Molecular Formula | C20H23ClO3P+ |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2-chloro-6-methoxybenzoyl)-oxo-(6-phenylhexyl)phosphanium |
| SMILES | COc1cccc(Cl)c1C(=O)[P+](=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C20H23ClO3P/c1-24-18-14-9-13-17(21)19(18)20(22)25(23)15-8-3-2-5-10-16-11-6-4-7-12-16/h4,6-7,9,11-14H,2-3,5,8,10,15H2,1H3/q+1 |
| InChIKey | SYGXODVCDFUCHA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|