C20H24O4P+ — CID 66688109
(2,6-dimethoxybenzoyl)-oxo-(5-phenylpentyl)phosphanium (PubChem CID 66688109) has the molecular formula C20H24O4P+ and a molecular weight of 359.38 g/mol. Its IUPAC name is (2,6-dimethoxybenzoyl)-oxo-(5-phenylpentyl)phosphanium.
| Compound Name | (2,6-dimethoxybenzoyl)-oxo-(5-phenylpentyl)phosphanium |
|---|---|
| PubChem CID | 66688109 |
| Molecular Formula | C20H24O4P+ |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2,6-dimethoxybenzoyl)-oxo-(5-phenylpentyl)phosphanium |
| SMILES | COc1cccc(OC)c1C(=O)[P+](=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C20H24O4P/c1-23-17-13-9-14-18(24-2)19(17)20(21)25(22)15-8-4-7-12-16-10-5-3-6-11-16/h3,5-6,9-11,13-14H,4,7-8,12,15H2,1-2H3/q+1 |
| InChIKey | UDJAVHCUMTUWIA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|