C21H13Br2ClO4P+ — CID 70014800
(3-benzoyl-2,6-dibromophenyl)-(2-chloro-6-methoxybenzoyl)-oxophosphanium (PubChem CID 70014800) has the molecular formula C21H13Br2ClO4P+ and a molecular weight of 555.57 g/mol. Its IUPAC name is (3-benzoyl-2,6-dibromophenyl)-(2-chloro-6-methoxybenzoyl)-oxophosphanium.
| Compound Name | (3-benzoyl-2,6-dibromophenyl)-(2-chloro-6-methoxybenzoyl)-oxophosphanium |
|---|---|
| PubChem CID | 70014800 |
| Molecular Formula | C21H13Br2ClO4P+ |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 552.86 |
| IUPAC Name | (3-benzoyl-2,6-dibromophenyl)-(2-chloro-6-methoxybenzoyl)-oxophosphanium |
| SMILES | COc1cccc(Cl)c1C(=O)[P+](=O)c1c(Br)ccc(C(=O)c2ccccc2)c1Br |
| InChI | InChI=1S/C21H13Br2ClO4P/c1-28-16-9-5-8-15(24)17(16)21(26)29(27)20-14(22)11-10-13(18(20)23)19(25)12-6-3-2-4-7-12/h2-11H,1H3/q+1 |
| InChIKey | FPAQUWAXQPGCQQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|