C15H12BrClO3 — CID 115813439
(4-bromo-3-chlorophenyl)-(2,6-dimethoxyphenyl)methanone (PubChem CID 115813439) has the molecular formula C15H12BrClO3 and a molecular weight of 355.62 g/mol. Its IUPAC name is (4-bromo-3-chlorophenyl)-(2,6-dimethoxyphenyl)methanone.
| Compound Name | (4-bromo-3-chlorophenyl)-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 115813439 |
| Molecular Formula | C15H12BrClO3 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | (4-bromo-3-chlorophenyl)-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H12BrClO3/c1-19-12-4-3-5-13(20-2)14(12)15(18)9-6-7-10(16)11(17)8-9/h3-8H,1-2H3 |
| InChIKey | BGLZPGQGJXRQCV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |