C15H11BrClFO3 — CID 82873343
(2-bromo-4,6-dimethoxyphenyl)-(3-chloro-4-fluorophenyl)methanone (PubChem CID 82873343) has the molecular formula C15H11BrClFO3 and a molecular weight of 373.61 g/mol. Its IUPAC name is (2-bromo-4,6-dimethoxyphenyl)-(3-chloro-4-fluorophenyl)methanone.
| Compound Name | (2-bromo-4,6-dimethoxyphenyl)-(3-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 82873343 |
| Molecular Formula | C15H11BrClFO3 |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | (2-bromo-4,6-dimethoxyphenyl)-(3-chloro-4-fluorophenyl)methanone |
| SMILES | COc1cc(Br)c(C(=O)c2ccc(F)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C15H11BrClFO3/c1-20-9-6-10(16)14(13(7-9)21-2)15(19)8-3-4-12(18)11(17)5-8/h3-7H,1-2H3 |
| InChIKey | QOAMBCACIAYJQZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |