C15H14BrNO3 — CID 116811602
(5-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methanone (PubChem CID 116811602) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is (5-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methanone.
| Compound Name | (5-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 116811602 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (5-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C15H14BrNO3/c1-19-12-4-3-5-13(20-2)14(12)15(18)10-8-9(17)6-7-11(10)16/h3-8H,17H2,1-2H3 |
| InChIKey | XCWRWKVQKXXIDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|