C22H22O3P+ — CID 158979600
oxo(diphenyl)phosphanium;2,4,6-trimethylbenzoic acid (PubChem CID 158979600) has the molecular formula C22H22O3P+ and a molecular weight of 365.39 g/mol. Its IUPAC name is oxo(diphenyl)phosphanium;2,4,6-trimethylbenzoic acid.
| Compound Name | oxo(diphenyl)phosphanium;2,4,6-trimethylbenzoic acid |
|---|---|
| PubChem CID | 158979600 |
| Molecular Formula | C22H22O3P+ |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | oxo(diphenyl)phosphanium;2,4,6-trimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(C)c1.O=[P+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10OP.C10H12O2/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6-4-7(2)9(10(11)12)8(3)5-6/h1-10H;4-5H,1-3H3,(H,11,12)/q+1; |
| InChIKey | UHXCUEAJODAUPL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|