About cadmium;oxo(diphenyl)phosphanium
cadmium;oxo(diphenyl)phosphanium (PubChem CID 174925548) has the molecular formula C12H10CdOP+
and a molecular weight of 313.60 g/mol. Its IUPAC name is cadmium;oxo(diphenyl)phosphanium.
Molecular Properties
| Compound Name | cadmium;oxo(diphenyl)phosphanium |
| PubChem CID | 174925548 |
| Molecular Formula | C12H10CdOP+ |
| Molecular Weight | 313.60 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | cadmium;oxo(diphenyl)phosphanium |
| SMILES | O=[P+](c1ccccc1)c1ccccc1.[Cd] |
| InChI | InChI=1S/C12H10OP.Cd/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;/q+1; |
| InChIKey | LYIGRRDJFXJHAX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cadmium;oxo(diphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;oxo(diphenyl)phosphanium?
The IUPAC name of cadmium;oxo(diphenyl)phosphanium (CID 174925548) is cadmium;oxo(diphenyl)phosphanium.
What is the SMILES notation for cadmium;oxo(diphenyl)phosphanium?
The canonical SMILES for cadmium;oxo(diphenyl)phosphanium is O=[P+](c1ccccc1)c1ccccc1.[Cd].
What is the InChIKey of cadmium;oxo(diphenyl)phosphanium?
The InChIKey is LYIGRRDJFXJHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OP.Cd/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;/q+1;.
What are the key properties of cadmium;oxo(diphenyl)phosphanium?
cadmium;oxo(diphenyl)phosphanium has a molecular weight of 313.60 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;oxo(diphenyl)phosphanium is sourced from PubChem (CID 174925548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).