About methanol;oxo(diphenyl)phosphanium
methanol;oxo(diphenyl)phosphanium (PubChem CID 174996285) has the molecular formula C13H14O2P+
and a molecular weight of 233.23 g/mol. Its IUPAC name is methanol;oxo(diphenyl)phosphanium.
Molecular Properties
| Compound Name | methanol;oxo(diphenyl)phosphanium |
| PubChem CID | 174996285 |
| Molecular Formula | C13H14O2P+ |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methanol;oxo(diphenyl)phosphanium |
| SMILES | CO.O=[P+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10OP.CH4O/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10H;2H,1H3/q+1; |
| InChIKey | PDZSYPOLSBYLQK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methanol;oxo(diphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;oxo(diphenyl)phosphanium?
The IUPAC name of methanol;oxo(diphenyl)phosphanium (CID 174996285) is methanol;oxo(diphenyl)phosphanium.
What is the SMILES notation for methanol;oxo(diphenyl)phosphanium?
The canonical SMILES for methanol;oxo(diphenyl)phosphanium is CO.O=[P+](c1ccccc1)c1ccccc1.
What is the InChIKey of methanol;oxo(diphenyl)phosphanium?
The InChIKey is PDZSYPOLSBYLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OP.CH4O/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10H;2H,1H3/q+1;.
What are the key properties of methanol;oxo(diphenyl)phosphanium?
methanol;oxo(diphenyl)phosphanium has a molecular weight of 233.23 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;oxo(diphenyl)phosphanium is sourced from PubChem (CID 174996285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).