About dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride
dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride (PubChem CID 172736603) has the molecular formula C6H6Cl4Mg2O2P+
and a molecular weight of 331.51 g/mol. Its IUPAC name is dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride.
Molecular Properties
| Compound Name | dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride |
| PubChem CID | 172736603 |
| Molecular Formula | C6H6Cl4Mg2O2P+ |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 328.86 |
| IUPAC Name | dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride |
| SMILES | O=[P+](O)c1ccccc1.[Cl-].[Cl-].[Cl-].[Cl-].[Mg+2].[Mg+2] |
| InChI | InChI=1S/C6H5O2P.4ClH.2Mg/c7-9(8)6-4-2-1-3-5-6;;;;;;/h1-5H;4*1H;;/q;;;;;2*+2/p-3 |
| InChIKey | OHCZMUMMOMBGMB-UHFFFAOYSA-K |
| XLogP | -11.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | -11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride?
The IUPAC name of dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride (CID 172736603) is dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride.
What is the SMILES notation for dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride?
The canonical SMILES for dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride is O=[P+](O)c1ccccc1.[Cl-].[Cl-].[Cl-].[Cl-].[Mg+2].[Mg+2].
What is the InChIKey of dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride?
The InChIKey is OHCZMUMMOMBGMB-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H5O2P.4ClH.2Mg/c7-9(8)6-4-2-1-3-5-6;;;;;;/h1-5H;4*1H;;/q;;;;;2*+2/p-3.
What are the key properties of dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride?
dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride has a molecular weight of 331.51 g/mol, XLogP of -11.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimagnesium;hydroxy-oxo-phenylphosphanium;tetrachloride is sourced from PubChem (CID 172736603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).