About aniline;hydroxy-oxo-phenylphosphanium
aniline;hydroxy-oxo-phenylphosphanium (PubChem CID 12791082) has the molecular formula C12H13NO2P+
and a molecular weight of 234.22 g/mol. Its IUPAC name is aniline;hydroxy-oxo-phenylphosphanium.
Molecular Properties
| Compound Name | aniline;hydroxy-oxo-phenylphosphanium |
| PubChem CID | 12791082 |
| Molecular Formula | C12H13NO2P+ |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | aniline;hydroxy-oxo-phenylphosphanium |
| SMILES | Nc1ccccc1.O=[P+](O)c1ccccc1 |
| InChI | InChI=1S/C6H7N.C6H5O2P/c7-6-4-2-1-3-5-6;7-9(8)6-4-2-1-3-5-6/h1-5H,7H2;1-5H/p+1 |
| InChIKey | UTUAQPRPWDOIFF-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aniline;hydroxy-oxo-phenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;hydroxy-oxo-phenylphosphanium?
The IUPAC name of aniline;hydroxy-oxo-phenylphosphanium (CID 12791082) is aniline;hydroxy-oxo-phenylphosphanium.
What is the SMILES notation for aniline;hydroxy-oxo-phenylphosphanium?
The canonical SMILES for aniline;hydroxy-oxo-phenylphosphanium is Nc1ccccc1.O=[P+](O)c1ccccc1.
What is the InChIKey of aniline;hydroxy-oxo-phenylphosphanium?
The InChIKey is UTUAQPRPWDOIFF-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H7N.C6H5O2P/c7-6-4-2-1-3-5-6;7-9(8)6-4-2-1-3-5-6/h1-5H,7H2;1-5H/p+1.
What are the key properties of aniline;hydroxy-oxo-phenylphosphanium?
aniline;hydroxy-oxo-phenylphosphanium has a molecular weight of 234.22 g/mol, XLogP of 2.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;hydroxy-oxo-phenylphosphanium is sourced from PubChem (CID 12791082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).