About tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium
tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium (PubChem CID 173147544) has the molecular formula C22H46O6PTi+
and a molecular weight of 485.45 g/mol. Its IUPAC name is tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium.
Molecular Properties
| Compound Name | tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium |
| PubChem CID | 173147544 |
| Molecular Formula | C22H46O6PTi+ |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium |
| SMILES | CCCCO.CCCCO.CCCCO.CCCCO.O=[P+](O)c1ccccc1.[Ti] |
| InChI | InChI=1S/C6H5O2P.4C4H10O.Ti/c7-9(8)6-4-2-1-3-5-6;4*1-2-3-4-5;/h1-5H;4*5H,2-4H2,1H3;/p+1 |
| InChIKey | BSROGTMHLDELCQ-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium?
The IUPAC name of tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium (CID 173147544) is tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium.
What is the SMILES notation for tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium?
The canonical SMILES for tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium is CCCCO.CCCCO.CCCCO.CCCCO.O=[P+](O)c1ccccc1.[Ti].
What is the InChIKey of tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium?
The InChIKey is BSROGTMHLDELCQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H5O2P.4C4H10O.Ti/c7-9(8)6-4-2-1-3-5-6;4*1-2-3-4-5;/h1-5H;4*5H,2-4H2,1H3;/p+1.
What are the key properties of tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium?
tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium has a molecular weight of 485.45 g/mol, XLogP of 4.16, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(butan-1-ol);hydroxy-oxo-phenylphosphanium;titanium is sourced from PubChem (CID 173147544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).